About N-(2-oxothiolan-3-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide
N-(2-oxothiolan-3-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide (PubChem CID 5013420) has the molecular formula C19H16N2O4S2
and a molecular weight of 400.48 g/mol. Its IUPAC name is N-(2-oxothiolan-3-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(2-oxothiolan-3-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide |
| PubChem CID | 5013420 |
| Molecular Formula | C19H16N2O4S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N-(2-oxothiolan-3-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide |
| SMILES | O=C1SCCC1NS(=O)(=O)c1nc(-c2ccccc2)oc1-c1ccccc1 |
| InChI | InChI=1S/C19H16N2O4S2/c22-19-15(11-12-26-19)21-27(23,24)18-16(13-7-3-1-4-8-13)25-17(20-18)14-9-5-2-6-10-14/h1-10,15,21H,11-12H2 |
| InChIKey | DRXGBMPFQQSGJO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze N-(2-oxothiolan-3-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-oxothiolan-3-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide?
The IUPAC name of N-(2-oxothiolan-3-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide (CID 5013420) is N-(2-oxothiolan-3-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide.
What is the SMILES notation for N-(2-oxothiolan-3-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide?
The canonical SMILES for N-(2-oxothiolan-3-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide is O=C1SCCC1NS(=O)(=O)c1nc(-c2ccccc2)oc1-c1ccccc1.
What is the InChIKey of N-(2-oxothiolan-3-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide?
The InChIKey is DRXGBMPFQQSGJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O4S2/c22-19-15(11-12-26-19)21-27(23,24)18-16(13-7-3-1-4-8-13)25-17(20-18)14-9-5-2-6-10-14/h1-10,15,21H,11-12H2.
What are the key properties of N-(2-oxothiolan-3-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide?
N-(2-oxothiolan-3-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide has a molecular weight of 400.48 g/mol, XLogP of 3.32, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-oxothiolan-3-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide is sourced from PubChem (CID 5013420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).