C20H26N2O3 — CID 501423
6-[(3,5-dimethylphenyl)methyl]-5-propan-2-yl-1-(prop-2-enoxymethyl)pyrimidine-2,4-dione (PubChem CID 501423) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 6-[(3,5-dimethylphenyl)methyl]-5-propan-2-yl-1-(prop-2-enoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 6-[(3,5-dimethylphenyl)methyl]-5-propan-2-yl-1-(prop-2-enoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 501423 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 6-[(3,5-dimethylphenyl)methyl]-5-propan-2-yl-1-(prop-2-enoxymethyl)pyrimidine-2,4-dione |
| SMILES | C=CCOCn1c(Cc2cc(C)cc(C)c2)c(C(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H26N2O3/c1-6-7-25-12-22-17(11-16-9-14(4)8-15(5)10-16)18(13(2)3)19(23)21-20(22)24/h6,8-10,13H,1,7,11-12H2,2-5H3,(H,21,23,24) |
| InChIKey | UDMGLORBANGVFE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|