C22H30N2O3 — CID 501424
6-[(3,5-dimethylphenyl)methyl]-1-(3-methylbut-2-enoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione (PubChem CID 501424) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 6-[(3,5-dimethylphenyl)methyl]-1-(3-methylbut-2-enoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione.
| Compound Name | 6-[(3,5-dimethylphenyl)methyl]-1-(3-methylbut-2-enoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 501424 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 6-[(3,5-dimethylphenyl)methyl]-1-(3-methylbut-2-enoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione |
| SMILES | CC(C)=CCOCn1c(Cc2cc(C)cc(C)c2)c(C(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H30N2O3/c1-14(2)7-8-27-13-24-19(12-18-10-16(5)9-17(6)11-18)20(15(3)4)21(25)23-22(24)26/h7,9-11,15H,8,12-13H2,1-6H3,(H,23,25,26) |
| InChIKey | RBWGESXLGALITQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|