C19H26N5O+ — CID 5014296
N-[4-(dimethylamino)phenyl]-2-(4-pyridin-2-ylpiperazin-1-ium-1-yl)acetamide (PubChem CID 5014296) has the molecular formula C19H26N5O+ and a molecular weight of 340.45 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-(4-pyridin-2-ylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-(4-pyridin-2-ylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 5014296 |
| Molecular Formula | C19H26N5O+ |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-(4-pyridin-2-ylpiperazin-1-ium-1-yl)acetamide |
| SMILES | CN(C)c1ccc(NC(=O)C[NH+]2CCN(c3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C19H25N5O/c1-22(2)17-8-6-16(7-9-17)21-19(25)15-23-11-13-24(14-12-23)18-5-3-4-10-20-18/h3-10H,11-15H2,1-2H3,(H,21,25)/p+1 |
| InChIKey | SRUOLTXXQCIGRM-UHFFFAOYSA-O |
| XLogP | 0.49 |
| TPSA | 52.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|