C26H26N4O3 — CID 5014909
9-butyl-17-(4-methoxyphenyl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,8,10,16-hexaene-13,15-dione (PubChem CID 5014909) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 9-butyl-17-(4-methoxyphenyl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,8,10,16-hexaene-13,15-dione.
| Compound Name | 9-butyl-17-(4-methoxyphenyl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,8,10,16-hexaene-13,15-dione |
|---|---|
| PubChem CID | 5014909 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 9-butyl-17-(4-methoxyphenyl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,8,10,16-hexaene-13,15-dione |
| SMILES | CCCCc1nc2ccccc2n2c(-c3ccc(OC)cc3)c3c(=O)n(C)c(=O)n(C)c3c12 |
| InChI | InChI=1S/C26H26N4O3/c1-5-6-9-19-23-24-21(25(31)29(3)26(32)28(24)2)22(16-12-14-17(33-4)15-13-16)30(23)20-11-8-7-10-18(20)27-19/h7-8,10-15H,5-6,9H2,1-4H3 |
| InChIKey | KRBDWWOUZSJWTF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 70.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |