C28H22N4O3 — CID 5014910
17-(4-methoxyphenyl)-12,14-dimethyl-9-phenyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,8,10,16-hexaene-13,15-dione (PubChem CID 5014910) has the molecular formula C28H22N4O3 and a molecular weight of 462.51 g/mol. Its IUPAC name is 17-(4-methoxyphenyl)-12,14-dimethyl-9-phenyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,8,10,16-hexaene-13,15-dione.
| Compound Name | 17-(4-methoxyphenyl)-12,14-dimethyl-9-phenyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,8,10,16-hexaene-13,15-dione |
|---|---|
| PubChem CID | 5014910 |
| Molecular Formula | C28H22N4O3 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 17-(4-methoxyphenyl)-12,14-dimethyl-9-phenyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,8,10,16-hexaene-13,15-dione |
| SMILES | COc1ccc(-c2c3c(=O)n(C)c(=O)n(C)c3c3c(-c4ccccc4)nc4ccccc4n23)cc1 |
| InChI | InChI=1S/C28H22N4O3/c1-30-25-22(27(33)31(2)28(30)34)24(18-13-15-19(35-3)16-14-18)32-21-12-8-7-11-20(21)29-23(26(25)32)17-9-5-4-6-10-17/h4-16H,1-3H3 |
| InChIKey | XTZQSZDRHRXPEG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 70.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |