C11H15N5O2 — CID 501517
(1R,2S,3R,5S)-3-(6-aminopurin-9-yl)-5-methylcyclopentane-1,2-diol (PubChem CID 501517) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-(6-aminopurin-9-yl)-5-methylcyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-(6-aminopurin-9-yl)-5-methylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 501517 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (1R,2S,3R,5S)-3-(6-aminopurin-9-yl)-5-methylcyclopentane-1,2-diol |
| SMILES | C[C@H]1C[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H15N5O2/c1-5-2-6(9(18)8(5)17)16-4-15-7-10(12)13-3-14-11(7)16/h3-6,8-9,17-18H,2H2,1H3,(H2,12,13,14)/t5-,6+,8+,9-/m0/s1 |
| InChIKey | WWXGAYAYPQEAGA-LWIVVEGESA-N |
| XLogP | -0.29 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |