About ethyl 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]hexanoate
ethyl 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]hexanoate (PubChem CID 5015575) has the molecular formula C16H19F6NO4S
and a molecular weight of 435.39 g/mol. Its IUPAC name is ethyl 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]hexanoate.
Molecular Properties
| Compound Name | ethyl 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]hexanoate |
| PubChem CID | 5015575 |
| Molecular Formula | C16H19F6NO4S |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | ethyl 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]hexanoate |
| SMILES | CCCCC(NS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)OCC |
| InChI | InChI=1S/C16H19F6NO4S/c1-3-5-6-13(14(24)27-4-2)23-28(25,26)12-8-10(15(17,18)19)7-11(9-12)16(20,21)22/h7-9,13,23H,3-6H2,1-2H3 |
| InChIKey | DSIAIAZIIMONFS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]hexanoate?
The IUPAC name of ethyl 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]hexanoate (CID 5015575) is ethyl 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]hexanoate.
What is the SMILES notation for ethyl 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]hexanoate?
The canonical SMILES for ethyl 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]hexanoate is CCCCC(NS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)OCC.
What is the InChIKey of ethyl 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]hexanoate?
The InChIKey is DSIAIAZIIMONFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F6NO4S/c1-3-5-6-13(14(24)27-4-2)23-28(25,26)12-8-10(15(17,18)19)7-11(9-12)16(20,21)22/h7-9,13,23H,3-6H2,1-2H3.
What are the key properties of ethyl 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]hexanoate?
ethyl 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]hexanoate has a molecular weight of 435.39 g/mol, XLogP of 4.12, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]hexanoate is sourced from PubChem (CID 5015575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).