C24H28N6O3S3 — CID 5017658
2-[[5-(4-ethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide (PubChem CID 5017658) has the molecular formula C24H28N6O3S3 and a molecular weight of 544.73 g/mol. Its IUPAC name is 2-[[5-(4-ethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[[5-(4-ethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 5017658 |
| Molecular Formula | C24H28N6O3S3 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 2-[[5-(4-ethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide |
| SMILES | CCc1ccc(Nc2nnc(SCC(=O)Nc3cccc(S(=O)(=O)NC4=NCCCCC4)c3)s2)cc1 |
| InChI | InChI=1S/C24H28N6O3S3/c1-2-17-10-12-18(13-11-17)27-23-28-29-24(35-23)34-16-22(31)26-19-7-6-8-20(15-19)36(32,33)30-21-9-4-3-5-14-25-21/h6-8,10-13,15H,2-5,9,14,16H2,1H3,(H,25,30)(H,26,31)(H,27,28) |
| InChIKey | JCZQPCIRUGQQBR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 125.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |