About [1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-morpholin-4-ylmethanone
[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-morpholin-4-ylmethanone (PubChem CID 5017782) has the molecular formula C22H22N4O4
and a molecular weight of 406.44 g/mol. Its IUPAC name is [1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-morpholin-4-ylmethanone |
| PubChem CID | 5017782 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | [1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1ccc(-n2nc(-c3ccc([N+](=O)[O-])cc3)cc2C(=O)N2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C22H22N4O4/c1-15-3-8-20(16(2)13-15)25-21(22(27)24-9-11-30-12-10-24)14-19(23-25)17-4-6-18(7-5-17)26(28)29/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | ZJOAJQCWUTYHQY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-morpholin-4-ylmethanone?
The IUPAC name of [1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-morpholin-4-ylmethanone (CID 5017782) is [1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-morpholin-4-ylmethanone is Cc1ccc(-n2nc(-c3ccc([N+](=O)[O-])cc3)cc2C(=O)N2CCOCC2)c(C)c1.
What is the InChIKey of [1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-morpholin-4-ylmethanone?
The InChIKey is ZJOAJQCWUTYHQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O4/c1-15-3-8-20(16(2)13-15)25-21(22(27)24-9-11-30-12-10-24)14-19(23-25)17-4-6-18(7-5-17)26(28)29/h3-8,13-14H,9-12H2,1-2H3.
What are the key properties of [1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-morpholin-4-ylmethanone?
[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-morpholin-4-ylmethanone has a molecular weight of 406.44 g/mol, XLogP of 3.54, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 5017782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).