About 6-amino-1-benzyl-5-(oxolan-2-ylmethylamino)pyrimidine-2,4-dione
6-amino-1-benzyl-5-(oxolan-2-ylmethylamino)pyrimidine-2,4-dione (PubChem CID 5017987) has the molecular formula C16H20N4O3
and a molecular weight of 316.36 g/mol. Its IUPAC name is 6-amino-1-benzyl-5-(oxolan-2-ylmethylamino)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-amino-1-benzyl-5-(oxolan-2-ylmethylamino)pyrimidine-2,4-dione |
| PubChem CID | 5017987 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 6-amino-1-benzyl-5-(oxolan-2-ylmethylamino)pyrimidine-2,4-dione |
| SMILES | Nc1c(NCC2CCCO2)c(=O)[nH]c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C16H20N4O3/c17-14-13(18-9-12-7-4-8-23-12)15(21)19-16(22)20(14)10-11-5-2-1-3-6-11/h1-3,5-6,12,18H,4,7-10,17H2,(H,19,21,22) |
| InChIKey | NWLKCGNIXRBJHY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-amino-1-benzyl-5-(oxolan-2-ylmethylamino)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1-benzyl-5-(oxolan-2-ylmethylamino)pyrimidine-2,4-dione?
The IUPAC name of 6-amino-1-benzyl-5-(oxolan-2-ylmethylamino)pyrimidine-2,4-dione (CID 5017987) is 6-amino-1-benzyl-5-(oxolan-2-ylmethylamino)pyrimidine-2,4-dione.
What is the SMILES notation for 6-amino-1-benzyl-5-(oxolan-2-ylmethylamino)pyrimidine-2,4-dione?
The canonical SMILES for 6-amino-1-benzyl-5-(oxolan-2-ylmethylamino)pyrimidine-2,4-dione is Nc1c(NCC2CCCO2)c(=O)[nH]c(=O)n1Cc1ccccc1.
What is the InChIKey of 6-amino-1-benzyl-5-(oxolan-2-ylmethylamino)pyrimidine-2,4-dione?
The InChIKey is NWLKCGNIXRBJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O3/c17-14-13(18-9-12-7-4-8-23-12)15(21)19-16(22)20(14)10-11-5-2-1-3-6-11/h1-3,5-6,12,18H,4,7-10,17H2,(H,19,21,22).
What are the key properties of 6-amino-1-benzyl-5-(oxolan-2-ylmethylamino)pyrimidine-2,4-dione?
6-amino-1-benzyl-5-(oxolan-2-ylmethylamino)pyrimidine-2,4-dione has a molecular weight of 316.36 g/mol, XLogP of 0.76, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1-benzyl-5-(oxolan-2-ylmethylamino)pyrimidine-2,4-dione is sourced from PubChem (CID 5017987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).