C10H8Cl2N2S — CID 5018022
4-(2,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-amine (PubChem CID 5018022) has the molecular formula C10H8Cl2N2S and a molecular weight of 259.16 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 5018022 |
| Molecular Formula | C10H8Cl2N2S |
| Molecular Weight | 259.16 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1sc(N)nc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H8Cl2N2S/c1-5-9(14-10(13)15-5)7-3-2-6(11)4-8(7)12/h2-4H,1H3,(H2,13,14) |
| InChIKey | SUELLSJOIIXFPP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.16 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |