About sodium 2-[2-(2,6-dichloroanilino)phenyl]acetate
sodium 2-[2-(2,6-dichloroanilino)phenyl]acetate (PubChem CID 5018304) has the molecular formula C14H10Cl2NNaO2
and a molecular weight of 318.14 g/mol. Its IUPAC name is sodium 2-[2-(2,6-dichloroanilino)phenyl]acetate.
Molecular Properties
| Compound Name | sodium 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| PubChem CID | 5018304 |
| Molecular Formula | C14H10Cl2NNaO2 |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | sodium 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| SMILES | O=C([O-])Cc1ccccc1Nc1c(Cl)cccc1Cl.[Na+] |
| InChI | InChI=1S/C14H11Cl2NO2.Na/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;/h1-7,17H,8H2,(H,18,19);/q;+1/p-1 |
| InChIKey | KPHWPUGNDIVLNH-UHFFFAOYSA-M |
| XLogP | 0.03 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium 2-[2-(2,6-dichloroanilino)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-[2-(2,6-dichloroanilino)phenyl]acetate?
The IUPAC name of sodium 2-[2-(2,6-dichloroanilino)phenyl]acetate (CID 5018304) is sodium 2-[2-(2,6-dichloroanilino)phenyl]acetate.
What is the SMILES notation for sodium 2-[2-(2,6-dichloroanilino)phenyl]acetate?
The canonical SMILES for sodium 2-[2-(2,6-dichloroanilino)phenyl]acetate is O=C([O-])Cc1ccccc1Nc1c(Cl)cccc1Cl.[Na+].
What is the InChIKey of sodium 2-[2-(2,6-dichloroanilino)phenyl]acetate?
The InChIKey is KPHWPUGNDIVLNH-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H11Cl2NO2.Na/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;/h1-7,17H,8H2,(H,18,19);/q;+1/p-1.
What are the key properties of sodium 2-[2-(2,6-dichloroanilino)phenyl]acetate?
sodium 2-[2-(2,6-dichloroanilino)phenyl]acetate has a molecular weight of 318.14 g/mol, XLogP of 0.03, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-[2-(2,6-dichloroanilino)phenyl]acetate is sourced from PubChem (CID 5018304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).