About N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine
N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine (PubChem CID 5018499) has the molecular formula C16H16N2OS
and a molecular weight of 284.38 g/mol. Its IUPAC name is N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine |
| PubChem CID | 5018499 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine |
| SMILES | CCOc1ccc2nc(NCc3ccccc3)sc2c1 |
| InChI | InChI=1S/C16H16N2OS/c1-2-19-13-8-9-14-15(10-13)20-16(18-14)17-11-12-6-4-3-5-7-12/h3-10H,2,11H2,1H3,(H,17,18) |
| InChIKey | WGWKHFGRLSGXBF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine?
The IUPAC name of N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine (CID 5018499) is N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine?
The canonical SMILES for N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine is CCOc1ccc2nc(NCc3ccccc3)sc2c1.
What is the InChIKey of N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine?
The InChIKey is WGWKHFGRLSGXBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2OS/c1-2-19-13-8-9-14-15(10-13)20-16(18-14)17-11-12-6-4-3-5-7-12/h3-10H,2,11H2,1H3,(H,17,18).
What are the key properties of N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine?
N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine has a molecular weight of 284.38 g/mol, XLogP of 4.31, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine is sourced from PubChem (CID 5018499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).