C16H20N2O3 — CID 5018828
4-(3-oxo-3-piperidin-1-ylpropyl)-1,4-benzoxazin-3-one (PubChem CID 5018828) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-(3-oxo-3-piperidin-1-ylpropyl)-1,4-benzoxazin-3-one.
| Compound Name | 4-(3-oxo-3-piperidin-1-ylpropyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 5018828 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-(3-oxo-3-piperidin-1-ylpropyl)-1,4-benzoxazin-3-one |
| SMILES | O=C(CCN1C(=O)COc2ccccc21)N1CCCCC1 |
| InChI | InChI=1S/C16H20N2O3/c19-15(17-9-4-1-5-10-17)8-11-18-13-6-2-3-7-14(13)21-12-16(18)20/h2-3,6-7H,1,4-5,8-12H2 |
| InChIKey | QEEYFVQNZBDCQW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |