About 2-amino-5-bromobenzamide
2-amino-5-bromobenzamide (PubChem CID 5019271) has the molecular formula C7H7BrN2O
and a molecular weight of 215.05 g/mol. Its IUPAC name is 2-amino-5-bromobenzamide.
Molecular Properties
| Compound Name | 2-amino-5-bromobenzamide |
| PubChem CID | 5019271 |
| Molecular Formula | C7H7BrN2O |
| Molecular Weight | 215.05 g/mol |
| Exact Mass | 213.97 |
| IUPAC Name | 2-amino-5-bromobenzamide |
| SMILES | NC(=O)c1cc(Br)ccc1N |
| InChI | InChI=1S/C7H7BrN2O/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H2,10,11) |
| InChIKey | LHAJKJQNMKXZSZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.05 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-bromobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-bromobenzamide?
The IUPAC name of 2-amino-5-bromobenzamide (CID 5019271) is 2-amino-5-bromobenzamide.
What is the SMILES notation for 2-amino-5-bromobenzamide?
The canonical SMILES for 2-amino-5-bromobenzamide is NC(=O)c1cc(Br)ccc1N.
What is the InChIKey of 2-amino-5-bromobenzamide?
The InChIKey is LHAJKJQNMKXZSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrN2O/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H2,10,11).
What are the key properties of 2-amino-5-bromobenzamide?
2-amino-5-bromobenzamide has a molecular weight of 215.05 g/mol, XLogP of 1.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-bromobenzamide is sourced from PubChem (CID 5019271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).