C16H16N4O3S2 — CID 5019580
N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)-4-methoxybenzenesulfonamide (PubChem CID 5019580) has the molecular formula C16H16N4O3S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)-4-methoxybenzenesulfonamide.
| Compound Name | N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 5019580 |
| Molecular Formula | C16H16N4O3S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2nc(SCc3ccccc3)n[nH]2)cc1 |
| InChI | InChI=1S/C16H16N4O3S2/c1-23-13-7-9-14(10-8-13)25(21,22)20-15-17-16(19-18-15)24-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H2,17,18,19,20) |
| InChIKey | LFQMSJAAIXRTJR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |