About 4-aminobutylurea
4-aminobutylurea (PubChem CID 502) has the molecular formula C5H13N3O
and a molecular weight of 131.18 g/mol. Its IUPAC name is 4-aminobutylurea.
Molecular Properties
| Compound Name | 4-aminobutylurea |
| PubChem CID | 502 |
| Molecular Formula | C5H13N3O |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | 4-aminobutylurea |
| SMILES | NCCCCNC(N)=O |
| InChI | InChI=1S/C5H13N3O/c6-3-1-2-4-8-5(7)9/h1-4,6H2,(H3,7,8,9) |
| InChIKey | YANFYYGANIYHGI-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobutylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobutylurea?
The IUPAC name of 4-aminobutylurea (CID 502) is 4-aminobutylurea.
What is the SMILES notation for 4-aminobutylurea?
The canonical SMILES for 4-aminobutylurea is NCCCCNC(N)=O.
What is the InChIKey of 4-aminobutylurea?
The InChIKey is YANFYYGANIYHGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3O/c6-3-1-2-4-8-5(7)9/h1-4,6H2,(H3,7,8,9).
What are the key properties of 4-aminobutylurea?
4-aminobutylurea has a molecular weight of 131.18 g/mol, XLogP of -0.61, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobutylurea is sourced from PubChem (CID 502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).