C13H24NO+ — CID 5020382
2-ethyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-1,3-benzoxazin-3-ium (PubChem CID 5020382) has the molecular formula C13H24NO+ and a molecular weight of 210.34 g/mol. Its IUPAC name is 2-ethyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-1,3-benzoxazin-3-ium.
| Compound Name | 2-ethyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 5020382 |
| Molecular Formula | C13H24NO+ |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.19 |
| IUPAC Name | 2-ethyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-1,3-benzoxazin-3-ium |
| SMILES | CCC1=[NH+]C(C)(C)C2CCC(C)CC2O1 |
| InChI | InChI=1S/C13H23NO/c1-5-12-14-13(3,4)10-7-6-9(2)8-11(10)15-12/h9-11H,5-8H2,1-4H3/p+1 |
| InChIKey | VXWWJYGVNBBVMG-UHFFFAOYSA-O |
| XLogP | 1.49 |
| TPSA | 23.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |