C18H13N5O2S — CID 5020679
6-(3-phenyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 5020679) has the molecular formula C18H13N5O2S and a molecular weight of 363.40 g/mol. Its IUPAC name is 6-(3-phenyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(3-phenyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 5020679 |
| Molecular Formula | C18H13N5O2S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 6-(3-phenyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C3=Nn4c(nnc4-c4ccccc4)SC3)cc2N1 |
| InChI | InChI=1S/C18H13N5O2S/c24-16-9-25-15-7-6-12(8-13(15)19-16)14-10-26-18-21-20-17(23(18)22-14)11-4-2-1-3-5-11/h1-8H,9-10H2,(H,19,24) |
| InChIKey | CQGWGYVWOJBXPW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |