C15H14F2N2O3 — CID 5021241
4-[4-(difluoromethoxy)phenyl]-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione (PubChem CID 5021241) has the molecular formula C15H14F2N2O3 and a molecular weight of 308.28 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)phenyl]-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione.
| Compound Name | 4-[4-(difluoromethoxy)phenyl]-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
|---|---|
| PubChem CID | 5021241 |
| Molecular Formula | C15H14F2N2O3 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 4-[4-(difluoromethoxy)phenyl]-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
| SMILES | O=C1NC2=C(C(=O)CCC2)C(c2ccc(OC(F)F)cc2)N1 |
| InChI | InChI=1S/C15H14F2N2O3/c16-14(17)22-9-6-4-8(5-7-9)13-12-10(18-15(21)19-13)2-1-3-11(12)20/h4-7,13-14H,1-3H2,(H2,18,19,21) |
| InChIKey | SDWXJVAZKRQTAY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |