About 1,3-dimethyl-8-phenoxy-7-propylpurine-2,6-dione
1,3-dimethyl-8-phenoxy-7-propylpurine-2,6-dione (PubChem CID 5022155) has the molecular formula C16H18N4O3
and a molecular weight of 314.34 g/mol. Its IUPAC name is 1,3-dimethyl-8-phenoxy-7-propylpurine-2,6-dione.
Molecular Properties
| Compound Name | 1,3-dimethyl-8-phenoxy-7-propylpurine-2,6-dione |
| PubChem CID | 5022155 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1,3-dimethyl-8-phenoxy-7-propylpurine-2,6-dione |
| SMILES | CCCn1c(Oc2ccccc2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H18N4O3/c1-4-10-20-12-13(18(2)16(22)19(3)14(12)21)17-15(20)23-11-8-6-5-7-9-11/h5-9H,4,10H2,1-3H3 |
| InChIKey | SYRFPSHSXZABGR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,3-dimethyl-8-phenoxy-7-propylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-8-phenoxy-7-propylpurine-2,6-dione?
The IUPAC name of 1,3-dimethyl-8-phenoxy-7-propylpurine-2,6-dione (CID 5022155) is 1,3-dimethyl-8-phenoxy-7-propylpurine-2,6-dione.
What is the SMILES notation for 1,3-dimethyl-8-phenoxy-7-propylpurine-2,6-dione?
The canonical SMILES for 1,3-dimethyl-8-phenoxy-7-propylpurine-2,6-dione is CCCn1c(Oc2ccccc2)nc2c1c(=O)n(C)c(=O)n2C.
What is the InChIKey of 1,3-dimethyl-8-phenoxy-7-propylpurine-2,6-dione?
The InChIKey is SYRFPSHSXZABGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O3/c1-4-10-20-12-13(18(2)16(22)19(3)14(12)21)17-15(20)23-11-8-6-5-7-9-11/h5-9H,4,10H2,1-3H3.
What are the key properties of 1,3-dimethyl-8-phenoxy-7-propylpurine-2,6-dione?
1,3-dimethyl-8-phenoxy-7-propylpurine-2,6-dione has a molecular weight of 314.34 g/mol, XLogP of 1.64, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-8-phenoxy-7-propylpurine-2,6-dione is sourced from PubChem (CID 5022155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).