C17H14ClN3O2 — CID 5022492
4-(2-chloroquinolin-3-yl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione (PubChem CID 5022492) has the molecular formula C17H14ClN3O2 and a molecular weight of 327.77 g/mol. Its IUPAC name is 4-(2-chloroquinolin-3-yl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione.
| Compound Name | 4-(2-chloroquinolin-3-yl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
|---|---|
| PubChem CID | 5022492 |
| Molecular Formula | C17H14ClN3O2 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-(2-chloroquinolin-3-yl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
| SMILES | O=C1NC2=C(C(=O)CCC2)C(c2cc3ccccc3nc2Cl)N1 |
| InChI | InChI=1S/C17H14ClN3O2/c18-16-10(8-9-4-1-2-5-11(9)19-16)15-14-12(20-17(23)21-15)6-3-7-13(14)22/h1-2,4-5,8,15H,3,6-7H2,(H2,20,21,23) |
| InChIKey | MAXHRCAOCHZCBT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|