About 2-(2,5-difluorophenyl)-7-ethyl-2,3-dihydro-1H-indole
2-(2,5-difluorophenyl)-7-ethyl-2,3-dihydro-1H-indole (PubChem CID 5023223) has the molecular formula C16H15F2N
and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-7-ethyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 2-(2,5-difluorophenyl)-7-ethyl-2,3-dihydro-1H-indole |
| PubChem CID | 5023223 |
| Molecular Formula | C16H15F2N |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-(2,5-difluorophenyl)-7-ethyl-2,3-dihydro-1H-indole |
| SMILES | CCc1cccc2c1NC(c1cc(F)ccc1F)C2 |
| InChI | InChI=1S/C16H15F2N/c1-2-10-4-3-5-11-8-15(19-16(10)11)13-9-12(17)6-7-14(13)18/h3-7,9,15,19H,2,8H2,1H3 |
| InChIKey | SFZRCLYDGKWTFC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,5-difluorophenyl)-7-ethyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-difluorophenyl)-7-ethyl-2,3-dihydro-1H-indole?
The IUPAC name of 2-(2,5-difluorophenyl)-7-ethyl-2,3-dihydro-1H-indole (CID 5023223) is 2-(2,5-difluorophenyl)-7-ethyl-2,3-dihydro-1H-indole.
What is the SMILES notation for 2-(2,5-difluorophenyl)-7-ethyl-2,3-dihydro-1H-indole?
The canonical SMILES for 2-(2,5-difluorophenyl)-7-ethyl-2,3-dihydro-1H-indole is CCc1cccc2c1NC(c1cc(F)ccc1F)C2.
What is the InChIKey of 2-(2,5-difluorophenyl)-7-ethyl-2,3-dihydro-1H-indole?
The InChIKey is SFZRCLYDGKWTFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F2N/c1-2-10-4-3-5-11-8-15(19-16(10)11)13-9-12(17)6-7-14(13)18/h3-7,9,15,19H,2,8H2,1H3.
What are the key properties of 2-(2,5-difluorophenyl)-7-ethyl-2,3-dihydro-1H-indole?
2-(2,5-difluorophenyl)-7-ethyl-2,3-dihydro-1H-indole has a molecular weight of 259.30 g/mol, XLogP of 4.24, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-difluorophenyl)-7-ethyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 5023223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).