About 4-nitro-3,5-diphenyl-1,2-oxazole
4-nitro-3,5-diphenyl-1,2-oxazole (PubChem CID 5023418) has the molecular formula C15H10N2O3
and a molecular weight of 266.26 g/mol. Its IUPAC name is 4-nitro-3,5-diphenyl-1,2-oxazole.
Molecular Properties
| Compound Name | 4-nitro-3,5-diphenyl-1,2-oxazole |
| PubChem CID | 5023418 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 4-nitro-3,5-diphenyl-1,2-oxazole |
| SMILES | O=[N+]([O-])c1c(-c2ccccc2)noc1-c1ccccc1 |
| InChI | InChI=1S/C15H10N2O3/c18-17(19)14-13(11-7-3-1-4-8-11)16-20-15(14)12-9-5-2-6-10-12/h1-10H |
| InChIKey | ALGSQPBNFXGLFZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-3,5-diphenyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-3,5-diphenyl-1,2-oxazole?
The IUPAC name of 4-nitro-3,5-diphenyl-1,2-oxazole (CID 5023418) is 4-nitro-3,5-diphenyl-1,2-oxazole.
What is the SMILES notation for 4-nitro-3,5-diphenyl-1,2-oxazole?
The canonical SMILES for 4-nitro-3,5-diphenyl-1,2-oxazole is O=[N+]([O-])c1c(-c2ccccc2)noc1-c1ccccc1.
What is the InChIKey of 4-nitro-3,5-diphenyl-1,2-oxazole?
The InChIKey is ALGSQPBNFXGLFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O3/c18-17(19)14-13(11-7-3-1-4-8-11)16-20-15(14)12-9-5-2-6-10-12/h1-10H.
What are the key properties of 4-nitro-3,5-diphenyl-1,2-oxazole?
4-nitro-3,5-diphenyl-1,2-oxazole has a molecular weight of 266.26 g/mol, XLogP of 3.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-3,5-diphenyl-1,2-oxazole is sourced from PubChem (CID 5023418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).