C19H17ClIN3 — CID 5024679
3-(3-chlorophenyl)-1-(4-iodophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine (PubChem CID 5024679) has the molecular formula C19H17ClIN3 and a molecular weight of 449.72 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-(4-iodophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine.
| Compound Name | 3-(3-chlorophenyl)-1-(4-iodophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine |
|---|---|
| PubChem CID | 5024679 |
| Molecular Formula | C19H17ClIN3 |
| Molecular Weight | 449.72 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | 3-(3-chlorophenyl)-1-(4-iodophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine |
| SMILES | Clc1cccc(-c2nn(-c3ccc(I)cc3)c3c2CCCCN3)c1 |
| InChI | InChI=1S/C19H17ClIN3/c20-14-5-3-4-13(12-14)18-17-6-1-2-11-22-19(17)24(23-18)16-9-7-15(21)8-10-16/h3-5,7-10,12,22H,1-2,6,11H2 |
| InChIKey | RLRPPCDKSCWTOX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.72 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|