About 2,6-ditert-butyl-4-(3-hydroxy-2,2-dimethylpropyl)phenol
2,6-ditert-butyl-4-(3-hydroxy-2,2-dimethylpropyl)phenol (PubChem CID 5024764) has the molecular formula C19H32O2
and a molecular weight of 292.46 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(3-hydroxy-2,2-dimethylpropyl)phenol.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-4-(3-hydroxy-2,2-dimethylpropyl)phenol |
| PubChem CID | 5024764 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2,6-ditert-butyl-4-(3-hydroxy-2,2-dimethylpropyl)phenol |
| SMILES | CC(C)(CO)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H32O2/c1-17(2,3)14-9-13(11-19(7,8)12-20)10-15(16(14)21)18(4,5)6/h9-10,20-21H,11-12H2,1-8H3 |
| InChIKey | XLWJPQQFJNGUPA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-ditert-butyl-4-(3-hydroxy-2,2-dimethylpropyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-4-(3-hydroxy-2,2-dimethylpropyl)phenol?
The IUPAC name of 2,6-ditert-butyl-4-(3-hydroxy-2,2-dimethylpropyl)phenol (CID 5024764) is 2,6-ditert-butyl-4-(3-hydroxy-2,2-dimethylpropyl)phenol.
What is the SMILES notation for 2,6-ditert-butyl-4-(3-hydroxy-2,2-dimethylpropyl)phenol?
The canonical SMILES for 2,6-ditert-butyl-4-(3-hydroxy-2,2-dimethylpropyl)phenol is CC(C)(CO)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2,6-ditert-butyl-4-(3-hydroxy-2,2-dimethylpropyl)phenol?
The InChIKey is XLWJPQQFJNGUPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O2/c1-17(2,3)14-9-13(11-19(7,8)12-20)10-15(16(14)21)18(4,5)6/h9-10,20-21H,11-12H2,1-8H3.
What are the key properties of 2,6-ditert-butyl-4-(3-hydroxy-2,2-dimethylpropyl)phenol?
2,6-ditert-butyl-4-(3-hydroxy-2,2-dimethylpropyl)phenol has a molecular weight of 292.46 g/mol, XLogP of 4.55, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-4-(3-hydroxy-2,2-dimethylpropyl)phenol is sourced from PubChem (CID 5024764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).