C22H21ClN4O8S2 — CID 5025306
N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]-2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetamide (PubChem CID 5025306) has the molecular formula C22H21ClN4O8S2 and a molecular weight of 569.02 g/mol. Its IUPAC name is N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]-2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetamide.
| Compound Name | N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]-2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetamide |
|---|---|
| PubChem CID | 5025306 |
| Molecular Formula | C22H21ClN4O8S2 |
| Molecular Weight | 569.02 g/mol |
| Exact Mass | 568.05 |
| IUPAC Name | N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]-2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1N(CC(=O)Nc1ccc(S(=O)(=O)Nc2ccccc2Cl)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C22H21ClN4O8S2/c1-35-21-12-9-16(27(29)30)13-20(21)26(36(2,31)32)14-22(28)24-15-7-10-17(11-8-15)37(33,34)25-19-6-4-3-5-18(19)23/h3-13,25H,14H2,1-2H3,(H,24,28) |
| InChIKey | PXMYJTFDQCNCMN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.02 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|