About dimethyl 1-(1-adamantylmethyl)-4-(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate
dimethyl 1-(1-adamantylmethyl)-4-(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 5026049) has the molecular formula C26H30FNO4
and a molecular weight of 439.53 g/mol. Its IUPAC name is dimethyl 1-(1-adamantylmethyl)-4-(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 1-(1-adamantylmethyl)-4-(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate |
| PubChem CID | 5026049 |
| Molecular Formula | C26H30FNO4 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | dimethyl 1-(1-adamantylmethyl)-4-(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=CN(CC23CC4CC(CC(C4)C2)C3)C=C(C(=O)OC)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H30FNO4/c1-31-24(29)21-13-28(15-26-10-16-7-17(11-26)9-18(8-16)12-26)14-22(25(30)32-2)23(21)19-3-5-20(27)6-4-19/h3-6,13-14,16-18,23H,7-12,15H2,1-2H3 |
| InChIKey | KGBQUYAWWDHRJF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dimethyl 1-(1-adamantylmethyl)-4-(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1-(1-adamantylmethyl)-4-(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate?
The IUPAC name of dimethyl 1-(1-adamantylmethyl)-4-(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate (CID 5026049) is dimethyl 1-(1-adamantylmethyl)-4-(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate.
What is the SMILES notation for dimethyl 1-(1-adamantylmethyl)-4-(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate?
The canonical SMILES for dimethyl 1-(1-adamantylmethyl)-4-(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate is COC(=O)C1=CN(CC23CC4CC(CC(C4)C2)C3)C=C(C(=O)OC)C1c1ccc(F)cc1.
What is the InChIKey of dimethyl 1-(1-adamantylmethyl)-4-(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate?
The InChIKey is KGBQUYAWWDHRJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30FNO4/c1-31-24(29)21-13-28(15-26-10-16-7-17(11-26)9-18(8-16)12-26)14-22(25(30)32-2)23(21)19-3-5-20(27)6-4-19/h3-6,13-14,16-18,23H,7-12,15H2,1-2H3.
What are the key properties of dimethyl 1-(1-adamantylmethyl)-4-(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate?
dimethyl 1-(1-adamantylmethyl)-4-(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate has a molecular weight of 439.53 g/mol, XLogP of 4.56, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1-(1-adamantylmethyl)-4-(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate is sourced from PubChem (CID 5026049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).