About 1-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]-4-(2-fluorophenyl)piperazine
1-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]-4-(2-fluorophenyl)piperazine (PubChem CID 5026762) has the molecular formula C22H25FN4
and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]-4-(2-fluorophenyl)piperazine.
Molecular Properties
| Compound Name | 1-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]-4-(2-fluorophenyl)piperazine |
| PubChem CID | 5026762 |
| Molecular Formula | C22H25FN4 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 1-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]-4-(2-fluorophenyl)piperazine |
| SMILES | Cc1ccc(-c2[nH]ncc2CN2CCN(c3ccccc3F)CC2)cc1C |
| InChI | InChI=1S/C22H25FN4/c1-16-7-8-18(13-17(16)2)22-19(14-24-25-22)15-26-9-11-27(12-10-26)21-6-4-3-5-20(21)23/h3-8,13-14H,9-12,15H2,1-2H3,(H,24,25) |
| InChIKey | KGPUIDWDWRJHFD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]-4-(2-fluorophenyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]-4-(2-fluorophenyl)piperazine?
The IUPAC name of 1-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]-4-(2-fluorophenyl)piperazine (CID 5026762) is 1-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]-4-(2-fluorophenyl)piperazine.
What is the SMILES notation for 1-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]-4-(2-fluorophenyl)piperazine?
The canonical SMILES for 1-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]-4-(2-fluorophenyl)piperazine is Cc1ccc(-c2[nH]ncc2CN2CCN(c3ccccc3F)CC2)cc1C.
What is the InChIKey of 1-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]-4-(2-fluorophenyl)piperazine?
The InChIKey is KGPUIDWDWRJHFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25FN4/c1-16-7-8-18(13-17(16)2)22-19(14-24-25-22)15-26-9-11-27(12-10-26)21-6-4-3-5-20(21)23/h3-8,13-14H,9-12,15H2,1-2H3,(H,24,25).
What are the key properties of 1-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]-4-(2-fluorophenyl)piperazine?
1-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]-4-(2-fluorophenyl)piperazine has a molecular weight of 364.47 g/mol, XLogP of 4.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]-4-(2-fluorophenyl)piperazine is sourced from PubChem (CID 5026762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).