C19H17O2S+ — CID 5026999
2-(2,6-dimethylpyrylium-4-yl)sulfanyl-1-naphthalen-2-ylethanone (PubChem CID 5026999) has the molecular formula C19H17O2S+ and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-(2,6-dimethylpyrylium-4-yl)sulfanyl-1-naphthalen-2-ylethanone.
| Compound Name | 2-(2,6-dimethylpyrylium-4-yl)sulfanyl-1-naphthalen-2-ylethanone |
|---|---|
| PubChem CID | 5026999 |
| Molecular Formula | C19H17O2S+ |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-(2,6-dimethylpyrylium-4-yl)sulfanyl-1-naphthalen-2-ylethanone |
| SMILES | Cc1cc(SCC(=O)c2ccc3ccccc3c2)cc(C)[o+]1 |
| InChI | InChI=1S/C19H17O2S/c1-13-9-18(10-14(2)21-13)22-12-19(20)17-8-7-15-5-3-4-6-16(15)11-17/h3-11H,12H2,1-2H3/q+1 |
| InChIKey | OCNJBJICKKCMAX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 28.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|