C17H16N2S — CID 5027193
2-ethylsulfanyl-4,5-diphenyl-1H-imidazole (PubChem CID 5027193) has the molecular formula C17H16N2S and a molecular weight of 280.40 g/mol. Its IUPAC name is 2-ethylsulfanyl-4,5-diphenyl-1H-imidazole.
| Compound Name | 2-ethylsulfanyl-4,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 5027193 |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-ethylsulfanyl-4,5-diphenyl-1H-imidazole |
| SMILES | CCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C17H16N2S/c1-2-20-17-18-15(13-9-5-3-6-10-13)16(19-17)14-11-7-4-8-12-14/h3-12H,2H2,1H3,(H,18,19) |
| InChIKey | LLMAFVWLNYBLIF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |