About 2-ethylsulfanyl-4,5-diphenyl-1H-imidazole
2-ethylsulfanyl-4,5-diphenyl-1H-imidazole (PubChem CID 5027193) has the molecular formula C17H16N2S
and a molecular weight of 280.40 g/mol. Its IUPAC name is 2-ethylsulfanyl-4,5-diphenyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-ethylsulfanyl-4,5-diphenyl-1H-imidazole |
| PubChem CID | 5027193 |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-ethylsulfanyl-4,5-diphenyl-1H-imidazole |
| SMILES | CCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C17H16N2S/c1-2-20-17-18-15(13-9-5-3-6-10-13)16(19-17)14-11-7-4-8-12-14/h3-12H,2H2,1H3,(H,18,19) |
| InChIKey | LLMAFVWLNYBLIF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylsulfanyl-4,5-diphenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanyl-4,5-diphenyl-1H-imidazole?
The IUPAC name of 2-ethylsulfanyl-4,5-diphenyl-1H-imidazole (CID 5027193) is 2-ethylsulfanyl-4,5-diphenyl-1H-imidazole.
What is the SMILES notation for 2-ethylsulfanyl-4,5-diphenyl-1H-imidazole?
The canonical SMILES for 2-ethylsulfanyl-4,5-diphenyl-1H-imidazole is CCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1.
What is the InChIKey of 2-ethylsulfanyl-4,5-diphenyl-1H-imidazole?
The InChIKey is LLMAFVWLNYBLIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2S/c1-2-20-17-18-15(13-9-5-3-6-10-13)16(19-17)14-11-7-4-8-12-14/h3-12H,2H2,1H3,(H,18,19).
What are the key properties of 2-ethylsulfanyl-4,5-diphenyl-1H-imidazole?
2-ethylsulfanyl-4,5-diphenyl-1H-imidazole has a molecular weight of 280.40 g/mol, XLogP of 4.86, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanyl-4,5-diphenyl-1H-imidazole is sourced from PubChem (CID 5027193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).