C16H17ClN2OS — CID 5027282
3-(3-chlorophenyl)-1,8,9-trimethyl-6-thia-2,3-diazaspiro[4.5]deca-1,8-dien-4-one (PubChem CID 5027282) has the molecular formula C16H17ClN2OS and a molecular weight of 320.85 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1,8,9-trimethyl-6-thia-2,3-diazaspiro[4.5]deca-1,8-dien-4-one.
| Compound Name | 3-(3-chlorophenyl)-1,8,9-trimethyl-6-thia-2,3-diazaspiro[4.5]deca-1,8-dien-4-one |
|---|---|
| PubChem CID | 5027282 |
| Molecular Formula | C16H17ClN2OS |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 3-(3-chlorophenyl)-1,8,9-trimethyl-6-thia-2,3-diazaspiro[4.5]deca-1,8-dien-4-one |
| SMILES | CC1=NN(c2cccc(Cl)c2)C(=O)C12CC(C)=C(C)CS2 |
| InChI | InChI=1S/C16H17ClN2OS/c1-10-8-16(21-9-11(10)2)12(3)18-19(15(16)20)14-6-4-5-13(17)7-14/h4-7H,8-9H2,1-3H3 |
| InChIKey | CAAQFTZFEXECTI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|