C26H26ClN5O7S — CID 5027402
ethyl 4-[4-(4-chloro-3-nitrophenyl)sulfonyl-3-methylpiperazine-1-carbonyl]-2-methyl-6-phenylpyrimidine-5-carboxylate (PubChem CID 5027402) has the molecular formula C26H26ClN5O7S and a molecular weight of 588.04 g/mol. Its IUPAC name is ethyl 4-[4-(4-chloro-3-nitrophenyl)sulfonyl-3-methylpiperazine-1-carbonyl]-2-methyl-6-phenylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[4-(4-chloro-3-nitrophenyl)sulfonyl-3-methylpiperazine-1-carbonyl]-2-methyl-6-phenylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 5027402 |
| Molecular Formula | C26H26ClN5O7S |
| Molecular Weight | 588.04 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | ethyl 4-[4-(4-chloro-3-nitrophenyl)sulfonyl-3-methylpiperazine-1-carbonyl]-2-methyl-6-phenylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(C(=O)N2CCN(S(=O)(=O)c3ccc(Cl)c([N+](=O)[O-])c3)C(C)C2)nc(C)nc1-c1ccccc1 |
| InChI | InChI=1S/C26H26ClN5O7S/c1-4-39-26(34)22-23(18-8-6-5-7-9-18)28-17(3)29-24(22)25(33)30-12-13-31(16(2)15-30)40(37,38)19-10-11-20(27)21(14-19)32(35)36/h5-11,14,16H,4,12-13,15H2,1-3H3 |
| InChIKey | QNIULQONBOOVNI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 152.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.04 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|