C44H55N3O8 — CID 5028370
N-[15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-4-cyano-N-methylbenzamide (PubChem CID 5028370) has the molecular formula C44H55N3O8 and a molecular weight of 753.94 g/mol. Its IUPAC name is N-[15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-4-cyano-N-methylbenzamide.
| Compound Name | N-[15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-4-cyano-N-methylbenzamide |
|---|---|
| PubChem CID | 5028370 |
| Molecular Formula | C44H55N3O8 |
| Molecular Weight | 753.94 g/mol |
| Exact Mass | 753.40 |
| IUPAC Name | N-[15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-4-cyano-N-methylbenzamide |
| SMILES | C=CCOc1ccc2c(c1)C1C(CCCCO)C(CCCCO)C=C3C(=NOC4CCCCO4)CC(N(C)C(=O)c4ccc(C#N)cc4)C(OCC=C)(O2)C31 |
| InChI | InChI=1S/C44H55N3O8/c1-4-23-51-33-19-20-38-36(27-33)41-34(13-7-10-22-49)32(12-6-9-21-48)26-35-37(46-55-40-14-8-11-25-52-40)28-39(44(54-38,42(35)41)53-24-5-2)47(3)43(50)31-17-15-30(29-45)16-18-31/h4-5,15-20,26-27,32,34,39-42,48-49H,1-2,6-14,21-25,28H2,3H3 |
| InChIKey | AHHVPUBAMNEYJB-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 143.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.94 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|