About 5-(4-bromophenyl)-N-[(2,6-dichlorophenyl)methyl]-1-methylimidazol-2-amine
5-(4-bromophenyl)-N-[(2,6-dichlorophenyl)methyl]-1-methylimidazol-2-amine (PubChem CID 5028642) has the molecular formula C17H14BrCl2N3
and a molecular weight of 411.13 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-[(2,6-dichlorophenyl)methyl]-1-methylimidazol-2-amine.
Molecular Properties
| Compound Name | 5-(4-bromophenyl)-N-[(2,6-dichlorophenyl)methyl]-1-methylimidazol-2-amine |
| PubChem CID | 5028642 |
| Molecular Formula | C17H14BrCl2N3 |
| Molecular Weight | 411.13 g/mol |
| Exact Mass | 408.97 |
| IUPAC Name | 5-(4-bromophenyl)-N-[(2,6-dichlorophenyl)methyl]-1-methylimidazol-2-amine |
| SMILES | Cn1c(-c2ccc(Br)cc2)cnc1NCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H14BrCl2N3/c1-23-16(11-5-7-12(18)8-6-11)10-22-17(23)21-9-13-14(19)3-2-4-15(13)20/h2-8,10H,9H2,1H3,(H,21,22) |
| InChIKey | NDATYIUUNLDYEI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.13 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-bromophenyl)-N-[(2,6-dichlorophenyl)methyl]-1-methylimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenyl)-N-[(2,6-dichlorophenyl)methyl]-1-methylimidazol-2-amine?
The IUPAC name of 5-(4-bromophenyl)-N-[(2,6-dichlorophenyl)methyl]-1-methylimidazol-2-amine (CID 5028642) is 5-(4-bromophenyl)-N-[(2,6-dichlorophenyl)methyl]-1-methylimidazol-2-amine.
What is the SMILES notation for 5-(4-bromophenyl)-N-[(2,6-dichlorophenyl)methyl]-1-methylimidazol-2-amine?
The canonical SMILES for 5-(4-bromophenyl)-N-[(2,6-dichlorophenyl)methyl]-1-methylimidazol-2-amine is Cn1c(-c2ccc(Br)cc2)cnc1NCc1c(Cl)cccc1Cl.
What is the InChIKey of 5-(4-bromophenyl)-N-[(2,6-dichlorophenyl)methyl]-1-methylimidazol-2-amine?
The InChIKey is NDATYIUUNLDYEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrCl2N3/c1-23-16(11-5-7-12(18)8-6-11)10-22-17(23)21-9-13-14(19)3-2-4-15(13)20/h2-8,10H,9H2,1H3,(H,21,22).
What are the key properties of 5-(4-bromophenyl)-N-[(2,6-dichlorophenyl)methyl]-1-methylimidazol-2-amine?
5-(4-bromophenyl)-N-[(2,6-dichlorophenyl)methyl]-1-methylimidazol-2-amine has a molecular weight of 411.13 g/mol, XLogP of 5.77, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-N-[(2,6-dichlorophenyl)methyl]-1-methylimidazol-2-amine is sourced from PubChem (CID 5028642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).