C24H18ClIN2O4 — CID 5029168
4-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1-(4-iodophenyl)pyrazolidine-3,5-dione (PubChem CID 5029168) has the molecular formula C24H18ClIN2O4 and a molecular weight of 560.78 g/mol. Its IUPAC name is 4-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1-(4-iodophenyl)pyrazolidine-3,5-dione.
| Compound Name | 4-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1-(4-iodophenyl)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 5029168 |
| Molecular Formula | C24H18ClIN2O4 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.00 |
| IUPAC Name | 4-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1-(4-iodophenyl)pyrazolidine-3,5-dione |
| SMILES | COc1cc(C=C2C(=O)NN(c3ccc(I)cc3)C2=O)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H18ClIN2O4/c1-31-22-13-16(4-11-21(22)32-14-15-2-5-17(25)6-3-15)12-20-23(29)27-28(24(20)30)19-9-7-18(26)8-10-19/h2-13H,14H2,1H3,(H,27,29) |
| InChIKey | SCMSHMSVBJIHIM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|