About 4-(2-amino-4-phenyl-1,3-thiazol-3-ium-3-yl)butane-1-sulfonic acid
4-(2-amino-4-phenyl-1,3-thiazol-3-ium-3-yl)butane-1-sulfonic acid (PubChem CID 5029743) has the molecular formula C13H17N2O3S2+
and a molecular weight of 313.42 g/mol. Its IUPAC name is 4-(2-amino-4-phenyl-1,3-thiazol-3-ium-3-yl)butane-1-sulfonic acid.
Molecular Properties
| Compound Name | 4-(2-amino-4-phenyl-1,3-thiazol-3-ium-3-yl)butane-1-sulfonic acid |
| PubChem CID | 5029743 |
| Molecular Formula | C13H17N2O3S2+ |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-(2-amino-4-phenyl-1,3-thiazol-3-ium-3-yl)butane-1-sulfonic acid |
| SMILES | Nc1scc(-c2ccccc2)[n+]1CCCCS(=O)(=O)O |
| InChI | InChI=1S/C13H16N2O3S2/c14-13-15(8-4-5-9-20(16,17)18)12(10-19-13)11-6-2-1-3-7-11/h1-3,6-7,10,14H,4-5,8-9H2,(H,16,17,18)/p+1 |
| InChIKey | VFZGPHSAGZJQBS-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-amino-4-phenyl-1,3-thiazol-3-ium-3-yl)butane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-4-phenyl-1,3-thiazol-3-ium-3-yl)butane-1-sulfonic acid?
The IUPAC name of 4-(2-amino-4-phenyl-1,3-thiazol-3-ium-3-yl)butane-1-sulfonic acid (CID 5029743) is 4-(2-amino-4-phenyl-1,3-thiazol-3-ium-3-yl)butane-1-sulfonic acid.
What is the SMILES notation for 4-(2-amino-4-phenyl-1,3-thiazol-3-ium-3-yl)butane-1-sulfonic acid?
The canonical SMILES for 4-(2-amino-4-phenyl-1,3-thiazol-3-ium-3-yl)butane-1-sulfonic acid is Nc1scc(-c2ccccc2)[n+]1CCCCS(=O)(=O)O.
What is the InChIKey of 4-(2-amino-4-phenyl-1,3-thiazol-3-ium-3-yl)butane-1-sulfonic acid?
The InChIKey is VFZGPHSAGZJQBS-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H16N2O3S2/c14-13-15(8-4-5-9-20(16,17)18)12(10-19-13)11-6-2-1-3-7-11/h1-3,6-7,10,14H,4-5,8-9H2,(H,16,17,18)/p+1.
What are the key properties of 4-(2-amino-4-phenyl-1,3-thiazol-3-ium-3-yl)butane-1-sulfonic acid?
4-(2-amino-4-phenyl-1,3-thiazol-3-ium-3-yl)butane-1-sulfonic acid has a molecular weight of 313.42 g/mol, XLogP of 1.95, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-4-phenyl-1,3-thiazol-3-ium-3-yl)butane-1-sulfonic acid is sourced from PubChem (CID 5029743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).