About 4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile
4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile (PubChem CID 5029867) has the molecular formula C8H2F3N3
and a molecular weight of 197.12 g/mol. Its IUPAC name is 4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile |
| PubChem CID | 5029867 |
| Molecular Formula | C8H2F3N3 |
| Molecular Weight | 197.12 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(F)c(N)c(F)c(F)c1C#N |
| InChI | InChI=1S/C8H2F3N3/c9-5-3(1-12)4(2-13)6(10)8(14)7(5)11/h14H2 |
| InChIKey | DWSBLPOJFMENII-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.12 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile?
The IUPAC name of 4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile (CID 5029867) is 4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile?
The canonical SMILES for 4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile is N#Cc1c(F)c(N)c(F)c(F)c1C#N.
What is the InChIKey of 4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile?
The InChIKey is DWSBLPOJFMENII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2F3N3/c9-5-3(1-12)4(2-13)6(10)8(14)7(5)11/h14H2.
What are the key properties of 4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile?
4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile has a molecular weight of 197.12 g/mol, XLogP of 1.43, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile is sourced from PubChem (CID 5029867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).