About 4-[(5,7-dinitroquinolin-8-yl)amino]phenol
4-[(5,7-dinitroquinolin-8-yl)amino]phenol (PubChem CID 5030546) has the molecular formula C15H10N4O5
and a molecular weight of 326.27 g/mol. Its IUPAC name is 4-[(5,7-dinitroquinolin-8-yl)amino]phenol.
Molecular Properties
| Compound Name | 4-[(5,7-dinitroquinolin-8-yl)amino]phenol |
| PubChem CID | 5030546 |
| Molecular Formula | C15H10N4O5 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 4-[(5,7-dinitroquinolin-8-yl)amino]phenol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2cccnc2c1Nc1ccc(O)cc1 |
| InChI | InChI=1S/C15H10N4O5/c20-10-5-3-9(4-6-10)17-15-13(19(23)24)8-12(18(21)22)11-2-1-7-16-14(11)15/h1-8,17,20H |
| InChIKey | VXHWSSFVSIVVNJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 131.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5,7-dinitroquinolin-8-yl)amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5,7-dinitroquinolin-8-yl)amino]phenol?
The IUPAC name of 4-[(5,7-dinitroquinolin-8-yl)amino]phenol (CID 5030546) is 4-[(5,7-dinitroquinolin-8-yl)amino]phenol.
What is the SMILES notation for 4-[(5,7-dinitroquinolin-8-yl)amino]phenol?
The canonical SMILES for 4-[(5,7-dinitroquinolin-8-yl)amino]phenol is O=[N+]([O-])c1cc([N+](=O)[O-])c2cccnc2c1Nc1ccc(O)cc1.
What is the InChIKey of 4-[(5,7-dinitroquinolin-8-yl)amino]phenol?
The InChIKey is VXHWSSFVSIVVNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N4O5/c20-10-5-3-9(4-6-10)17-15-13(19(23)24)8-12(18(21)22)11-2-1-7-16-14(11)15/h1-8,17,20H.
What are the key properties of 4-[(5,7-dinitroquinolin-8-yl)amino]phenol?
4-[(5,7-dinitroquinolin-8-yl)amino]phenol has a molecular weight of 326.27 g/mol, XLogP of 3.50, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,7-dinitroquinolin-8-yl)amino]phenol is sourced from PubChem (CID 5030546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).