About 2-(1H-benzimidazol-2-ylsulfanyl)-1,2-diphenylethanone
2-(1H-benzimidazol-2-ylsulfanyl)-1,2-diphenylethanone (PubChem CID 5030573) has the molecular formula C21H16N2OS
and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-1,2-diphenylethanone.
Molecular Properties
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-1,2-diphenylethanone |
| PubChem CID | 5030573 |
| Molecular Formula | C21H16N2OS |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)C(Sc1nc2ccccc2[nH]1)c1ccccc1 |
| InChI | InChI=1S/C21H16N2OS/c24-19(15-9-3-1-4-10-15)20(16-11-5-2-6-12-16)25-21-22-17-13-7-8-14-18(17)23-21/h1-14,20H,(H,22,23) |
| InChIKey | MDLPUNZSVCJTNH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-benzimidazol-2-ylsulfanyl)-1,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-benzimidazol-2-ylsulfanyl)-1,2-diphenylethanone?
The IUPAC name of 2-(1H-benzimidazol-2-ylsulfanyl)-1,2-diphenylethanone (CID 5030573) is 2-(1H-benzimidazol-2-ylsulfanyl)-1,2-diphenylethanone.
What is the SMILES notation for 2-(1H-benzimidazol-2-ylsulfanyl)-1,2-diphenylethanone?
The canonical SMILES for 2-(1H-benzimidazol-2-ylsulfanyl)-1,2-diphenylethanone is O=C(c1ccccc1)C(Sc1nc2ccccc2[nH]1)c1ccccc1.
What is the InChIKey of 2-(1H-benzimidazol-2-ylsulfanyl)-1,2-diphenylethanone?
The InChIKey is MDLPUNZSVCJTNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2OS/c24-19(15-9-3-1-4-10-15)20(16-11-5-2-6-12-16)25-21-22-17-13-7-8-14-18(17)23-21/h1-14,20H,(H,22,23).
What are the key properties of 2-(1H-benzimidazol-2-ylsulfanyl)-1,2-diphenylethanone?
2-(1H-benzimidazol-2-ylsulfanyl)-1,2-diphenylethanone has a molecular weight of 344.44 g/mol, XLogP of 5.28, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-benzimidazol-2-ylsulfanyl)-1,2-diphenylethanone is sourced from PubChem (CID 5030573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).