About [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-benzamido-3-phenylpropanoate
[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-benzamido-3-phenylpropanoate (PubChem CID 5030787) has the molecular formula C26H23N3O5S
and a molecular weight of 489.55 g/mol. Its IUPAC name is [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-benzamido-3-phenylpropanoate.
Molecular Properties
| Compound Name | [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-benzamido-3-phenylpropanoate |
| PubChem CID | 5030787 |
| Molecular Formula | C26H23N3O5S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-benzamido-3-phenylpropanoate |
| SMILES | COc1ccc2nc(NC(=O)COC(=O)CC(NC(=O)c3ccccc3)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C26H23N3O5S/c1-33-19-12-13-20-22(14-19)35-26(28-20)29-23(30)16-34-24(31)15-21(17-8-4-2-5-9-17)27-25(32)18-10-6-3-7-11-18/h2-14,21H,15-16H2,1H3,(H,27,32)(H,28,29,30) |
| InChIKey | QLOCSAUIBGQZLC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-benzamido-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-benzamido-3-phenylpropanoate?
The IUPAC name of [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-benzamido-3-phenylpropanoate (CID 5030787) is [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-benzamido-3-phenylpropanoate.
What is the SMILES notation for [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-benzamido-3-phenylpropanoate?
The canonical SMILES for [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-benzamido-3-phenylpropanoate is COc1ccc2nc(NC(=O)COC(=O)CC(NC(=O)c3ccccc3)c3ccccc3)sc2c1.
What is the InChIKey of [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-benzamido-3-phenylpropanoate?
The InChIKey is QLOCSAUIBGQZLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23N3O5S/c1-33-19-12-13-20-22(14-19)35-26(28-20)29-23(30)16-34-24(31)15-21(17-8-4-2-5-9-17)27-25(32)18-10-6-3-7-11-18/h2-14,21H,15-16H2,1H3,(H,27,32)(H,28,29,30).
What are the key properties of [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-benzamido-3-phenylpropanoate?
[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-benzamido-3-phenylpropanoate has a molecular weight of 489.55 g/mol, XLogP of 4.35, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-benzamido-3-phenylpropanoate is sourced from PubChem (CID 5030787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).