C26H28Br2O8 — CID 503122
methyl 3-bromo-5-[1-(3-bromo-4-methoxy-5-methoxycarbonylphenyl)-6-ethoxy-6-oxohex-1-enyl]-2-methoxybenzoate (PubChem CID 503122) has the molecular formula C26H28Br2O8 and a molecular weight of 628.31 g/mol. Its IUPAC name is methyl 3-bromo-5-[1-(3-bromo-4-methoxy-5-methoxycarbonylphenyl)-6-ethoxy-6-oxohex-1-enyl]-2-methoxybenzoate.
| Compound Name | methyl 3-bromo-5-[1-(3-bromo-4-methoxy-5-methoxycarbonylphenyl)-6-ethoxy-6-oxohex-1-enyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 503122 |
| Molecular Formula | C26H28Br2O8 |
| Molecular Weight | 628.31 g/mol |
| Exact Mass | 626.02 |
| IUPAC Name | methyl 3-bromo-5-[1-(3-bromo-4-methoxy-5-methoxycarbonylphenyl)-6-ethoxy-6-oxohex-1-enyl]-2-methoxybenzoate |
| SMILES | CCOC(=O)CCCC=C(c1cc(Br)c(OC)c(C(=O)OC)c1)c1cc(Br)c(OC)c(C(=O)OC)c1 |
| InChI | InChI=1S/C26H28Br2O8/c1-6-36-22(29)10-8-7-9-17(15-11-18(25(30)34-4)23(32-2)20(27)13-15)16-12-19(26(31)35-5)24(33-3)21(28)14-16/h9,11-14H,6-8,10H2,1-5H3 |
| InChIKey | JPJAAFZPKLIBBL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.31 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|