C19H17FN2O2S2 — CID 5031449
3-(4-ethoxyphenyl)-6-(4-fluorophenyl)-5-sulfanylidene-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-7-one (PubChem CID 5031449) has the molecular formula C19H17FN2O2S2 and a molecular weight of 388.49 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-6-(4-fluorophenyl)-5-sulfanylidene-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-7-one.
| Compound Name | 3-(4-ethoxyphenyl)-6-(4-fluorophenyl)-5-sulfanylidene-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-7-one |
|---|---|
| PubChem CID | 5031449 |
| Molecular Formula | C19H17FN2O2S2 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 3-(4-ethoxyphenyl)-6-(4-fluorophenyl)-5-sulfanylidene-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-7-one |
| SMILES | CCOc1ccc(C2SCC3C(=O)N(c4ccc(F)cc4)C(=S)N32)cc1 |
| InChI | InChI=1S/C19H17FN2O2S2/c1-2-24-15-9-3-12(4-10-15)18-22-16(11-26-18)17(23)21(19(22)25)14-7-5-13(20)6-8-14/h3-10,16,18H,2,11H2,1H3 |
| InChIKey | XFJXRABDRDDRFV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|