About 2-(2-fluorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate
2-(2-fluorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate (PubChem CID 5031571) has the molecular formula C27H24FNO6
and a molecular weight of 477.49 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate.
Molecular Properties
| Compound Name | 2-(2-fluorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate |
| PubChem CID | 5031571 |
| Molecular Formula | C27H24FNO6 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate |
| SMILES | COc1cc(-c2cc(C(=O)OCCOc3ccccc3F)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C27H24FNO6/c1-31-24-14-17(15-25(32-2)26(24)33-3)22-16-19(18-8-4-6-10-21(18)29-22)27(30)35-13-12-34-23-11-7-5-9-20(23)28/h4-11,14-16H,12-13H2,1-3H3 |
| InChIKey | YXHRSVFJOXKKQI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-fluorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate?
The IUPAC name of 2-(2-fluorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate (CID 5031571) is 2-(2-fluorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate.
What is the SMILES notation for 2-(2-fluorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate?
The canonical SMILES for 2-(2-fluorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate is COc1cc(-c2cc(C(=O)OCCOc3ccccc3F)c3ccccc3n2)cc(OC)c1OC.
What is the InChIKey of 2-(2-fluorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate?
The InChIKey is YXHRSVFJOXKKQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24FNO6/c1-31-24-14-17(15-25(32-2)26(24)33-3)22-16-19(18-8-4-6-10-21(18)29-22)27(30)35-13-12-34-23-11-7-5-9-20(23)28/h4-11,14-16H,12-13H2,1-3H3.
What are the key properties of 2-(2-fluorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate?
2-(2-fluorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate has a molecular weight of 477.49 g/mol, XLogP of 5.30, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate is sourced from PubChem (CID 5031571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).