C28H40O5 — CID 5031765
4,24-ditert-butyl-8,11,14,17,20-pentaoxatricyclo[19.4.0.02,7]pentacosa-1(21),2(7),3,5,22,24-hexaene (PubChem CID 5031765) has the molecular formula C28H40O5 and a molecular weight of 456.62 g/mol. Its IUPAC name is 4,24-ditert-butyl-8,11,14,17,20-pentaoxatricyclo[19.4.0.02,7]pentacosa-1(21),2(7),3,5,22,24-hexaene.
| Compound Name | 4,24-ditert-butyl-8,11,14,17,20-pentaoxatricyclo[19.4.0.02,7]pentacosa-1(21),2(7),3,5,22,24-hexaene |
|---|---|
| PubChem CID | 5031765 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 4,24-ditert-butyl-8,11,14,17,20-pentaoxatricyclo[19.4.0.02,7]pentacosa-1(21),2(7),3,5,22,24-hexaene |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1cc(C(C)(C)C)ccc1OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C28H40O5/c1-27(2,3)21-7-9-25-23(19-21)24-20-22(28(4,5)6)8-10-26(24)33-18-16-31-14-12-29-11-13-30-15-17-32-25/h7-10,19-20H,11-18H2,1-6H3 |
| InChIKey | OIQBRLUADURTRY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |