C39H53N5O5 — CID 503192
pyridin-2-ylmethyl N-[(2S,3S)-1-[[(2S,3R)-4-[(2S,4R)-2-(tert-butylcarbamoyl)-4-phenylpiperidin-1-yl]-3-hydroxy-1-phenylbutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 503192) has the molecular formula C39H53N5O5 and a molecular weight of 671.88 g/mol. Its IUPAC name is pyridin-2-ylmethyl N-[(2S,3S)-1-[[(2S,3R)-4-[(2S,4R)-2-(tert-butylcarbamoyl)-4-phenylpiperidin-1-yl]-3-hydroxy-1-phenylbutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | pyridin-2-ylmethyl N-[(2S,3S)-1-[[(2S,3R)-4-[(2S,4R)-2-(tert-butylcarbamoyl)-4-phenylpiperidin-1-yl]-3-hydroxy-1-phenylbutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 503192 |
| Molecular Formula | C39H53N5O5 |
| Molecular Weight | 671.88 g/mol |
| Exact Mass | 671.40 |
| IUPAC Name | pyridin-2-ylmethyl N-[(2S,3S)-1-[[(2S,3R)-4-[(2S,4R)-2-(tert-butylcarbamoyl)-4-phenylpiperidin-1-yl]-3-hydroxy-1-phenylbutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC[C@H](C)[C@H](NC(=O)OCc1ccccn1)C(=O)N[C@@H](Cc1ccccc1)[C@H](O)CN1CC[C@@H](c2ccccc2)C[C@H]1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C39H53N5O5/c1-6-27(2)35(42-38(48)49-26-31-19-13-14-21-40-31)37(47)41-32(23-28-15-9-7-10-16-28)34(45)25-44-22-20-30(29-17-11-8-12-18-29)24-33(44)36(46)43-39(3,4)5/h7-19,21,27,30,32-35,45H,6,20,22-26H2,1-5H3,(H,41,47)(H,42,48)(H,43,46)/t27-,30+,32-,33-,34+,35-/m0/s1 |
| InChIKey | VYERRBWHEUGMQL-WHBRBTLESA-N |
| XLogP | 4.97 |
| TPSA | 132.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.88 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |