C17H13F6N3O5 — CID 5032760
1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4-nitrophenyl)urea (PubChem CID 5032760) has the molecular formula C17H13F6N3O5 and a molecular weight of 453.30 g/mol. Its IUPAC name is 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 5032760 |
| Molecular Formula | C17H13F6N3O5 |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4-nitrophenyl)urea |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)Nc1cc(OCC(F)(F)F)cc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C17H13F6N3O5/c18-16(19,20)8-30-13-5-11(6-14(7-13)31-9-17(21,22)23)25-15(27)24-10-1-3-12(4-2-10)26(28)29/h1-7H,8-9H2,(H2,24,25,27) |
| InChIKey | MBIDOJTXHUGYAN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|