About 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-chromene
2-(2,4-dichlorophenyl)-3,4-dihydro-2H-chromene (PubChem CID 503327) has the molecular formula C15H12Cl2O
and a molecular weight of 279.17 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-chromene |
| PubChem CID | 503327 |
| Molecular Formula | C15H12Cl2O |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-chromene |
| SMILES | Clc1ccc(C2CCc3ccccc3O2)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl2O/c16-11-6-7-12(13(17)9-11)15-8-5-10-3-1-2-4-14(10)18-15/h1-4,6-7,9,15H,5,8H2 |
| InChIKey | URVXCMAGSWSNLS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-chromene?
The IUPAC name of 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-chromene (CID 503327) is 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-chromene.
What is the SMILES notation for 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-chromene?
The canonical SMILES for 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-chromene is Clc1ccc(C2CCc3ccccc3O2)c(Cl)c1.
What is the InChIKey of 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-chromene?
The InChIKey is URVXCMAGSWSNLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl2O/c16-11-6-7-12(13(17)9-11)15-8-5-10-3-1-2-4-14(10)18-15/h1-4,6-7,9,15H,5,8H2.
What are the key properties of 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-chromene?
2-(2,4-dichlorophenyl)-3,4-dihydro-2H-chromene has a molecular weight of 279.17 g/mol, XLogP of 5.06, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-chromene is sourced from PubChem (CID 503327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).