About ethyl 4-(1,3-thiazol-2-ylcarbamothioylamino)benzoate
ethyl 4-(1,3-thiazol-2-ylcarbamothioylamino)benzoate (PubChem CID 5034257) has the molecular formula C13H13N3O2S2
and a molecular weight of 307.40 g/mol. Its IUPAC name is ethyl 4-(1,3-thiazol-2-ylcarbamothioylamino)benzoate.
Molecular Properties
| Compound Name | ethyl 4-(1,3-thiazol-2-ylcarbamothioylamino)benzoate |
| PubChem CID | 5034257 |
| Molecular Formula | C13H13N3O2S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | ethyl 4-(1,3-thiazol-2-ylcarbamothioylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)Nc2nccs2)cc1 |
| InChI | InChI=1S/C13H13N3O2S2/c1-2-18-11(17)9-3-5-10(6-4-9)15-12(19)16-13-14-7-8-20-13/h3-8H,2H2,1H3,(H2,14,15,16,19) |
| InChIKey | BFDKIWQHBGTUNZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(1,3-thiazol-2-ylcarbamothioylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(1,3-thiazol-2-ylcarbamothioylamino)benzoate?
The IUPAC name of ethyl 4-(1,3-thiazol-2-ylcarbamothioylamino)benzoate (CID 5034257) is ethyl 4-(1,3-thiazol-2-ylcarbamothioylamino)benzoate.
What is the SMILES notation for ethyl 4-(1,3-thiazol-2-ylcarbamothioylamino)benzoate?
The canonical SMILES for ethyl 4-(1,3-thiazol-2-ylcarbamothioylamino)benzoate is CCOC(=O)c1ccc(NC(=S)Nc2nccs2)cc1.
What is the InChIKey of ethyl 4-(1,3-thiazol-2-ylcarbamothioylamino)benzoate?
The InChIKey is BFDKIWQHBGTUNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O2S2/c1-2-18-11(17)9-3-5-10(6-4-9)15-12(19)16-13-14-7-8-20-13/h3-8H,2H2,1H3,(H2,14,15,16,19).
What are the key properties of ethyl 4-(1,3-thiazol-2-ylcarbamothioylamino)benzoate?
ethyl 4-(1,3-thiazol-2-ylcarbamothioylamino)benzoate has a molecular weight of 307.40 g/mol, XLogP of 3.13, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(1,3-thiazol-2-ylcarbamothioylamino)benzoate is sourced from PubChem (CID 5034257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).